C16H22NO3- — CID 6567657
(1R,2S,3S,4S)-3-(cycloheptylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 6567657) has the molecular formula C16H22NO3- and a molecular weight of 276.36 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-(cycloheptylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3S,4S)-3-(cycloheptylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 6567657 |
| Molecular Formula | C16H22NO3- |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (1R,2S,3S,4S)-3-(cycloheptylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(NC1CCCCCC1)[C@@H]1[C@@H](C(=O)[O-])[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H23NO3/c18-15(17-12-5-3-1-2-4-6-12)13-10-7-8-11(9-10)14(13)16(19)20/h7-8,10-14H,1-6,9H2,(H,17,18)(H,19,20)/p-1/t10-,11+,13+,14+/m1/s1 |
| InChIKey | YQOYDGKIUYUEBF-XWUBHJNHSA-M |
| XLogP | 1.01 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|