C16H26NO3- — CID 2179462
trans-(1S,2S)-2-(cyclooctylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 2179462) has the molecular formula C16H26NO3- and a molecular weight of 280.39 g/mol. Its IUPAC name is trans-(1S,2S)-2-(cyclooctylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-(cyclooctylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2179462 |
| Molecular Formula | C16H26NO3- |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | trans-(1S,2S)-2-(cyclooctylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCC[C@@H]1C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C16H27NO3/c18-15(13-10-6-7-11-14(13)16(19)20)17-12-8-4-2-1-3-5-9-12/h12-14H,1-11H2,(H,17,18)(H,19,20)/p-1/t13-,14-/m0/s1 |
| InChIKey | WWGAHHKLEGAQCW-KBPBESRZSA-M |
| XLogP | 1.77 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |