C11H18NO3- — CID 6927821
cis-(1S,2R)-2-(propan-2-ylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 6927821) has the molecular formula C11H18NO3- and a molecular weight of 212.27 g/mol. Its IUPAC name is cis-(1S,2R)-2-(propan-2-ylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-(propan-2-ylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6927821 |
| Molecular Formula | C11H18NO3- |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | cis-(1S,2R)-2-(propan-2-ylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | CC(C)NC(=O)[C@@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C11H19NO3/c1-7(2)12-10(13)8-5-3-4-6-9(8)11(14)15/h7-9H,3-6H2,1-2H3,(H,12,13)(H,14,15)/p-1/t8-,9+/m1/s1 |
| InChIKey | LKHIMICNMRXHFN-BDAKNGLRSA-M |
| XLogP | 0.07 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |