C14H24NO4- — CID 7316354
trans-(1S,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 7316354) has the molecular formula C14H24NO4- and a molecular weight of 270.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7316354 |
| Molecular Formula | C14H24NO4- |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | trans-(1S,2S)-2-(3-propan-2-yloxypropylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | CC(C)OCCCNC(=O)[C@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H25NO4/c1-10(2)19-9-5-8-15-13(16)11-6-3-4-7-12(11)14(17)18/h10-12H,3-9H2,1-2H3,(H,15,16)(H,17,18)/p-1/t11-,12-/m0/s1 |
| InChIKey | ZGEOGSUUCJLJRE-RYUDHWBXSA-M |
| XLogP | 0.47 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|