C15H26NO4- — CID 7299891
trans-(1S,2S)-2-(3-butoxypropylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 7299891) has the molecular formula C15H26NO4- and a molecular weight of 284.38 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-butoxypropylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | trans-(1S,2S)-2-(3-butoxypropylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7299891 |
| Molecular Formula | C15H26NO4- |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | trans-(1S,2S)-2-(3-butoxypropylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | CCCCOCCCNC(=O)[C@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H27NO4/c1-2-3-10-20-11-6-9-16-14(17)12-7-4-5-8-13(12)15(18)19/h12-13H,2-11H2,1H3,(H,16,17)(H,18,19)/p-1/t12-,13-/m0/s1 |
| InChIKey | PRYUCOXAVFBUKT-STQMWFEESA-M |
| XLogP | 0.87 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|