C8H11AlO5 — CID 90236478
aluminum;cyclohexane-1,2-dicarboxylate;hydroxide (PubChem CID 90236478) has the molecular formula C8H11AlO5 and a molecular weight of 214.15 g/mol. Its IUPAC name is aluminum;cyclohexane-1,2-dicarboxylate;hydroxide.
| Compound Name | aluminum;cyclohexane-1,2-dicarboxylate;hydroxide |
|---|---|
| PubChem CID | 90236478 |
| Molecular Formula | C8H11AlO5 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | aluminum;cyclohexane-1,2-dicarboxylate;hydroxide |
| SMILES | O=C([O-])C1CCCCC1C(=O)[O-].[Al+3].[OH-] |
| InChI | InChI=1S/C8H12O4.Al.H2O/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h5-6H,1-4H2,(H,9,10)(H,11,12);;1H2/q;+3;/p-3 |
| InChIKey | FPVXYVCNVCUGKO-UHFFFAOYSA-K |
| XLogP | -2.27 |
| TPSA | 110.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |