C10H14BrO4- — CID 7052246
cis-(1R,2S)-2-(2-bromoethoxycarbonyl)cyclohexane-1-carboxylate (PubChem CID 7052246) has the molecular formula C10H14BrO4- and a molecular weight of 278.12 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-bromoethoxycarbonyl)cyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-(2-bromoethoxycarbonyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7052246 |
| Molecular Formula | C10H14BrO4- |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | cis-(1R,2S)-2-(2-bromoethoxycarbonyl)cyclohexane-1-carboxylate |
| SMILES | O=C(OCCBr)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C10H15BrO4/c11-5-6-15-10(14)8-4-2-1-3-7(8)9(12)13/h7-8H,1-6H2,(H,12,13)/p-1/t7-,8+/m1/s1 |
| InChIKey | FASMJWBFIFTBBL-SFYZADRCSA-M |
| XLogP | 0.48 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|