C10H15O4- — CID 71423369
cis-(1R,2S)-2-ethoxycarbonylcyclohexane-1-carboxylate (PubChem CID 71423369) has the molecular formula C10H15O4- and a molecular weight of 199.23 g/mol. Its IUPAC name is cis-(1R,2S)-2-ethoxycarbonylcyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-ethoxycarbonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71423369 |
| Molecular Formula | C10H15O4- |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | cis-(1R,2S)-2-ethoxycarbonylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C10H16O4/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12/h7-8H,2-6H2,1H3,(H,11,12)/p-1/t7-,8+/m1/s1 |
| InChIKey | XGRJGTBLDJAHTL-SFYZADRCSA-M |
| XLogP | 0.11 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |