C12H18Cl2O4 — CID 91697761
bis(2-chloroethyl) cyclohexane-1,2-dicarboxylate (PubChem CID 91697761) has the molecular formula C12H18Cl2O4 and a molecular weight of 297.18 g/mol. Its IUPAC name is bis(2-chloroethyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(2-chloroethyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91697761 |
| Molecular Formula | C12H18Cl2O4 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | bis(2-chloroethyl) cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(OCCCl)C1CCCCC1C(=O)OCCCl |
| InChI | InChI=1S/C12H18Cl2O4/c13-5-7-17-11(15)9-3-1-2-4-10(9)12(16)18-8-6-14/h9-10H,1-8H2 |
| InChIKey | IKIDGIJIVUSXNH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|