C13H13O4- — CID 71378393
cis-(1R,2S)-2-phenylmethoxycarbonylcyclobutane-1-carboxylate (PubChem CID 71378393) has the molecular formula C13H13O4- and a molecular weight of 233.24 g/mol. Its IUPAC name is cis-(1R,2S)-2-phenylmethoxycarbonylcyclobutane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-phenylmethoxycarbonylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 71378393 |
| Molecular Formula | C13H13O4- |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | cis-(1R,2S)-2-phenylmethoxycarbonylcyclobutane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C13H14O4/c14-12(15)10-6-7-11(10)13(16)17-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,14,15)/p-1/t10-,11+/m1/s1 |
| InChIKey | QPQJKZNHXUCVLC-MNOVXSKESA-M |
| XLogP | 0.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |