C7H11O3- — CID 41097361
cis-(1S,2R)-2-hydroxycyclohexane-1-carboxylate (PubChem CID 41097361) has the molecular formula C7H11O3- and a molecular weight of 143.16 g/mol. Its IUPAC name is cis-(1S,2R)-2-hydroxycyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 41097361 |
| Molecular Formula | C7H11O3- |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | cis-(1S,2R)-2-hydroxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C7H12O3/c8-6-4-2-1-3-5(6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/p-1/t5-,6+/m0/s1 |
| InChIKey | SNKAANHOVFZAMR-NTSWFWBYSA-M |
| XLogP | -0.71 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |