About bis(2-bromocyclohexane-1-carboxylate);cadmium(2+)
bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) (PubChem CID 22604911) has the molecular formula C14H20Br2CdO4
and a molecular weight of 524.53 g/mol. Its IUPAC name is bis(2-bromocyclohexane-1-carboxylate);cadmium(2+).
Molecular Properties
| Compound Name | bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) |
| PubChem CID | 22604911 |
| Molecular Formula | C14H20Br2CdO4 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 523.88 |
| IUPAC Name | bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) |
| SMILES | O=C([O-])C1CCCCC1Br.O=C([O-])C1CCCCC1Br.[Cd+2] |
| InChI | InChI=1S/2C7H11BrO2.Cd/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*5-6H,1-4H2,(H,9,10);/q;;+2/p-2 |
| InChIKey | GYBSQTYLOZEIFW-UHFFFAOYSA-L |
| XLogP | 1.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-bromocyclohexane-1-carboxylate);cadmium(2+)?
The IUPAC name of bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) (CID 22604911) is bis(2-bromocyclohexane-1-carboxylate);cadmium(2+).
What is the SMILES notation for bis(2-bromocyclohexane-1-carboxylate);cadmium(2+)?
The canonical SMILES for bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) is O=C([O-])C1CCCCC1Br.O=C([O-])C1CCCCC1Br.[Cd+2].
What is the InChIKey of bis(2-bromocyclohexane-1-carboxylate);cadmium(2+)?
The InChIKey is GYBSQTYLOZEIFW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H11BrO2.Cd/c2*8-6-4-2-1-3-5(6)7(9)10;/h2*5-6H,1-4H2,(H,9,10);/q;;+2/p-2.
What are the key properties of bis(2-bromocyclohexane-1-carboxylate);cadmium(2+)?
bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) has a molecular weight of 524.53 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-bromocyclohexane-1-carboxylate);cadmium(2+) is sourced from PubChem (CID 22604911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).