C12H22N2O — CID 64817156
2-amino-N-cyclohexylcyclopentane-1-carboxamide (PubChem CID 64817156) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-amino-N-cyclohexylcyclopentane-1-carboxamide.
| Compound Name | 2-amino-N-cyclohexylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 64817156 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 2-amino-N-cyclohexylcyclopentane-1-carboxamide |
| SMILES | NC1CCCC1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H22N2O/c13-11-8-4-7-10(11)12(15)14-9-5-2-1-3-6-9/h9-11H,1-8,13H2,(H,14,15) |
| InChIKey | YKWWRNRHRLIHLL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |