About 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide
2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide (PubChem CID 107221615) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide |
| PubChem CID | 107221615 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide |
| SMILES | NC1CCCCCC1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H26N2O2/c15-11-7-3-1-2-6-10(11)14(18)16-12-8-4-5-9-13(12)17/h10-13,17H,1-9,15H2,(H,16,18)/t10?,11?,12-,13-/m0/s1 |
| InChIKey | WSGRCRYZOPKTGS-TYUFSLCMSA-N |
| XLogP | 1.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide?
The IUPAC name of 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide (CID 107221615) is 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide.
What is the SMILES notation for 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide?
The canonical SMILES for 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide is NC1CCCCCC1C(=O)N[C@H]1CCCC[C@@H]1O.
What is the InChIKey of 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide?
The InChIKey is WSGRCRYZOPKTGS-TYUFSLCMSA-N. The full InChI is InChI=1S/C14H26N2O2/c15-11-7-3-1-2-6-10(11)14(18)16-12-8-4-5-9-13(12)17/h10-13,17H,1-9,15H2,(H,16,18)/t10?,11?,12-,13-/m0/s1.
What are the key properties of 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide?
2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide has a molecular weight of 254.37 g/mol, XLogP of 1.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(1S,2S)-2-hydroxycyclohexyl]cycloheptane-1-carboxamide is sourced from PubChem (CID 107221615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).