C12H20N2O2 — CID 79207326
4-amino-N-(2-hydroxycyclohexyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79207326) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxycyclohexyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(2-hydroxycyclohexyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79207326 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4-amino-N-(2-hydroxycyclohexyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NC2CCCCC2O)C1 |
| InChI | InChI=1S/C12H20N2O2/c13-9-6-5-8(7-9)12(16)14-10-3-1-2-4-11(10)15/h5-6,8-11,15H,1-4,7,13H2,(H,14,16) |
| InChIKey | NZCWSSMZUHCVGE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|