C13H22N2O — CID 81390649
4-amino-N-[(1S)-1-cyclopentylethyl]cyclopent-2-ene-1-carboxamide (PubChem CID 81390649) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-amino-N-[(1S)-1-cyclopentylethyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[(1S)-1-cyclopentylethyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 81390649 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-amino-N-[(1S)-1-cyclopentylethyl]cyclopent-2-ene-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1C=CC(N)C1)C1CCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-9(10-4-2-3-5-10)15-13(16)11-6-7-12(14)8-11/h6-7,9-12H,2-5,8,14H2,1H3,(H,15,16)/t9-,11?,12?/m0/s1 |
| InChIKey | FTVUAEKXIZFYNC-GCVQQVDUSA-N |
| XLogP | 1.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|