C11H20N2O3 — CID 79207526
4-amino-N-(1,1-dimethoxypropan-2-yl)cyclopent-2-ene-1-carboxamide (PubChem CID 79207526) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-amino-N-(1,1-dimethoxypropan-2-yl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(1,1-dimethoxypropan-2-yl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79207526 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4-amino-N-(1,1-dimethoxypropan-2-yl)cyclopent-2-ene-1-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C11H20N2O3/c1-7(11(15-2)16-3)13-10(14)8-4-5-9(12)6-8/h4-5,7-9,11H,6,12H2,1-3H3,(H,13,14) |
| InChIKey | HEDDPUIBJVNZES-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|