C10H16N2O4 — CID 106109009
3-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-2-methoxypropanoic acid (PubChem CID 106109009) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-2-methoxypropanoic acid.
| Compound Name | 3-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106109009 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)C1C=CC(N)C1)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-16-8(10(14)15)5-12-9(13)6-2-3-7(11)4-6/h2-3,6-8H,4-5,11H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | MTVZTCDDLYWGRX-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|