C11H20N2O — CID 79211552
4-amino-N-pentylcyclopent-2-ene-1-carboxamide (PubChem CID 79211552) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-amino-N-pentylcyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-pentylcyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79211552 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-amino-N-pentylcyclopent-2-ene-1-carboxamide |
| SMILES | CCCCCNC(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C11H20N2O/c1-2-3-4-7-13-11(14)9-5-6-10(12)8-9/h5-6,9-10H,2-4,7-8,12H2,1H3,(H,13,14) |
| InChIKey | FIPXLRLSNRLRGK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|