C9H14F2N2O2 — CID 106176733
4-amino-N-(2,2-difluoro-3-hydroxypropyl)cyclopent-2-ene-1-carboxamide (PubChem CID 106176733) has the molecular formula C9H14F2N2O2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoro-3-hydroxypropyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 106176733 |
| Molecular Formula | C9H14F2N2O2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-amino-N-(2,2-difluoro-3-hydroxypropyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCC(F)(F)CO)C1 |
| InChI | InChI=1S/C9H14F2N2O2/c10-9(11,5-14)4-13-8(15)6-1-2-7(12)3-6/h1-2,6-7,14H,3-5,12H2,(H,13,15) |
| InChIKey | XXABDLPATLKPRO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|