C8H15N3O — CID 79207691
4-amino-N-(2-aminoethyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79207691) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-amino-N-(2-aminoethyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(2-aminoethyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79207691 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-amino-N-(2-aminoethyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NCCNC(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C8H15N3O/c9-3-4-11-8(12)6-1-2-7(10)5-6/h1-2,6-7H,3-5,9-10H2,(H,11,12) |
| InChIKey | YNICRCATXVFTHH-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|