C10H13N3O2 — CID 106417005
4-amino-N-(1,2-oxazol-5-ylmethyl)cyclopent-2-ene-1-carboxamide (PubChem CID 106417005) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-amino-N-(1,2-oxazol-5-ylmethyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(1,2-oxazol-5-ylmethyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 106417005 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-amino-N-(1,2-oxazol-5-ylmethyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCc2ccno2)C1 |
| InChI | InChI=1S/C10H13N3O2/c11-8-2-1-7(5-8)10(14)12-6-9-3-4-13-15-9/h1-4,7-8H,5-6,11H2,(H,12,14) |
| InChIKey | HFVYVRDZNNGEIJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|