C11H13BrN2OS — CID 79208355
4-amino-N-[(5-bromothiophen-2-yl)methyl]cyclopent-2-ene-1-carboxamide (PubChem CID 79208355) has the molecular formula C11H13BrN2OS and a molecular weight of 301.21 g/mol. Its IUPAC name is 4-amino-N-[(5-bromothiophen-2-yl)methyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[(5-bromothiophen-2-yl)methyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79208355 |
| Molecular Formula | C11H13BrN2OS |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 4-amino-N-[(5-bromothiophen-2-yl)methyl]cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H13BrN2OS/c12-10-4-3-9(16-10)6-14-11(15)7-1-2-8(13)5-7/h1-4,7-8H,5-6,13H2,(H,14,15) |
| InChIKey | BXBLWEYVIMRVNV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|