C13H17N3O3S — CID 79210828
4-amino-N-[(4-sulfamoylphenyl)methyl]cyclopent-2-ene-1-carboxamide (PubChem CID 79210828) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 4-amino-N-[(4-sulfamoylphenyl)methyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[(4-sulfamoylphenyl)methyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79210828 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-amino-N-[(4-sulfamoylphenyl)methyl]cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C13H17N3O3S/c14-11-4-3-10(7-11)13(17)16-8-9-1-5-12(6-2-9)20(15,18)19/h1-6,10-11H,7-8,14H2,(H,16,17)(H2,15,18,19) |
| InChIKey | QXZXCLTWEQMYCX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|