C12H16N4O4S — CID 76890368
5-oxo-N-[(4-sulfamoylphenyl)methyl]piperazine-2-carboxamide (PubChem CID 76890368) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-oxo-N-[(4-sulfamoylphenyl)methyl]piperazine-2-carboxamide.
| Compound Name | 5-oxo-N-[(4-sulfamoylphenyl)methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 76890368 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-oxo-N-[(4-sulfamoylphenyl)methyl]piperazine-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C2CNC(=O)CN2)cc1 |
| InChI | InChI=1S/C12H16N4O4S/c13-21(19,20)9-3-1-8(2-4-9)5-16-12(18)10-6-15-11(17)7-14-10/h1-4,10,14H,5-7H2,(H,15,17)(H,16,18)(H2,13,19,20) |
| InChIKey | VXMNULBTHQFMMX-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |