C16H19N5O3S — CID 134086296
5-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]pyrazolidine-3-carboxamide (PubChem CID 134086296) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is 5-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134086296 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 5-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]pyrazolidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C2CC(c3cccnc3)NN2)cc1 |
| InChI | InChI=1S/C16H19N5O3S/c17-25(23,24)13-5-3-11(4-6-13)9-19-16(22)15-8-14(20-21-15)12-2-1-7-18-10-12/h1-7,10,14-15,20-21H,8-9H2,(H,19,22)(H2,17,23,24) |
| InChIKey | LQADVJNHWYZTCZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |