C17H21N5O2 — CID 134077005
5-(4-hydroxyphenyl)-N-[2-(pyridin-3-ylamino)ethyl]pyrazolidine-3-carboxamide (PubChem CID 134077005) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-N-[2-(pyridin-3-ylamino)ethyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(4-hydroxyphenyl)-N-[2-(pyridin-3-ylamino)ethyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134077005 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 5-(4-hydroxyphenyl)-N-[2-(pyridin-3-ylamino)ethyl]pyrazolidine-3-carboxamide |
| SMILES | O=C(NCCNc1cccnc1)C1CC(c2ccc(O)cc2)NN1 |
| InChI | InChI=1S/C17H21N5O2/c23-14-5-3-12(4-6-14)15-10-16(22-21-15)17(24)20-9-8-19-13-2-1-7-18-11-13/h1-7,11,15-16,19,21-23H,8-10H2,(H,20,24) |
| InChIKey | BWZJEHQRWSUNBW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|