C18H27N5O3 — CID 134080643
1-[2-[[5-(4-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]ethyl]piperidine-3-carboxamide (PubChem CID 134080643) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[2-[[5-(4-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-[[5-(4-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134080643 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-[2-[[5-(4-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]ethyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CCNC(=O)C2CC(c3ccc(O)cc3)NN2)C1 |
| InChI | InChI=1S/C18H27N5O3/c19-17(25)13-2-1-8-23(11-13)9-7-20-18(26)16-10-15(21-22-16)12-3-5-14(24)6-4-12/h3-6,13,15-16,21-22,24H,1-2,7-11H2,(H2,19,25)(H,20,26) |
| InChIKey | VTWMRHGFLRMPGQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |