C15H18N2O3 — CID 79208078
4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79208078) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79208078 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-amino-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NCc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C15H18N2O3/c16-12-3-2-11(8-12)15(18)17-9-10-1-4-13-14(7-10)20-6-5-19-13/h1-4,7,11-12H,5-6,8-9,16H2,(H,17,18) |
| InChIKey | DHEMTBAAPIIYCI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|