C9H11BrN2OS — CID 138041285
N-[(5-bromothiophen-2-yl)methyl]azetidine-1-carboxamide (PubChem CID 138041285) has the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]azetidine-1-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 138041285 |
| Molecular Formula | C9H11BrN2OS |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]azetidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(Br)s1)N1CCC1 |
| InChI | InChI=1S/C9H11BrN2OS/c10-8-3-2-7(14-8)6-11-9(13)12-4-1-5-12/h2-3H,1,4-6H2,(H,11,13) |
| InChIKey | DTTJBCDQCKPCHM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |