C14H15BrN2OS — CID 114609252
N-[(5-bromothiophen-2-yl)methyl]-1-cyclobutylpyrrole-2-carboxamide (PubChem CID 114609252) has the molecular formula C14H15BrN2OS and a molecular weight of 339.26 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1-cyclobutylpyrrole-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1-cyclobutylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114609252 |
| Molecular Formula | C14H15BrN2OS |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1-cyclobutylpyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)s1)c1cccn1C1CCC1 |
| InChI | InChI=1S/C14H15BrN2OS/c15-13-7-6-11(19-13)9-16-14(18)12-5-2-8-17(12)10-3-1-4-10/h2,5-8,10H,1,3-4,9H2,(H,16,18) |
| InChIKey | KEZABMMAQWJDLS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |