C15H17BrN2OS — CID 116564693
2-(5-bromothiophen-2-yl)-1-(1-piperidin-4-ylpyrrol-2-yl)ethanone (PubChem CID 116564693) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(1-piperidin-4-ylpyrrol-2-yl)ethanone.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(1-piperidin-4-ylpyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 116564693 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(1-piperidin-4-ylpyrrol-2-yl)ethanone |
| SMILES | O=C(Cc1ccc(Br)s1)c1cccn1C1CCNCC1 |
| InChI | InChI=1S/C15H17BrN2OS/c16-15-4-3-12(20-15)10-14(19)13-2-1-9-18(13)11-5-7-17-8-6-11/h1-4,9,11,17H,5-8,10H2 |
| InChIKey | GTQMASSBISXGQP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |