C14H17N3O3S2 — CID 75472961
1-cyclopropyl-N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]pyrrole-2-carboxamide (PubChem CID 75472961) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-cyclopropyl-N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]pyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75472961 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-cyclopropyl-N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)c2cccn2C2CC2)s1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-15-22(19,20)13-7-6-11(21-13)9-16-14(18)12-3-2-8-17(12)10-4-5-10/h2-3,6-8,10,15H,4-5,9H2,1H3,(H,16,18) |
| InChIKey | KEFNNHIJGBJCLI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |