C12H19N3O3S2 — CID 119698683
N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]-2-pyrrolidin-2-ylacetamide (PubChem CID 119698683) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119698683 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[[5-(methylsulfamoyl)thiophen-2-yl]methyl]-2-pyrrolidin-2-ylacetamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)CC2CCCN2)s1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-13-20(17,18)12-5-4-10(19-12)8-15-11(16)7-9-3-2-6-14-9/h4-5,9,13-14H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | WHYBBPZZJXKERM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |