C10H15N3O3 — CID 106417108
4-methoxy-N-(1,2-oxazol-5-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 106417108) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-methoxy-N-(1,2-oxazol-5-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 4-methoxy-N-(1,2-oxazol-5-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106417108 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-methoxy-N-(1,2-oxazol-5-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)NCc2ccno2)C1 |
| InChI | InChI=1S/C10H15N3O3/c1-15-8-4-9(11-6-8)10(14)12-5-7-2-3-13-16-7/h2-3,8-9,11H,4-6H2,1H3,(H,12,14) |
| InChIKey | AQJGCTIOMGQXKO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |