C15H20N2O4 — CID 61274724
methyl 4-[[(4-methoxypyrrolidine-2-carbonyl)amino]methyl]benzoate (PubChem CID 61274724) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-[[(4-methoxypyrrolidine-2-carbonyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-methoxypyrrolidine-2-carbonyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 61274724 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 4-[[(4-methoxypyrrolidine-2-carbonyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C2CC(OC)CN2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-12-7-13(16-9-12)14(18)17-8-10-3-5-11(6-4-10)15(19)21-2/h3-6,12-13,16H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | XIWFBDPRGGJTHL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |