C13H14N2O6-2 — CID 11896387
(1S,2S,3R,4R)-3-[[2-(carboxylatomethylamino)-2-oxoethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11896387) has the molecular formula C13H14N2O6-2 and a molecular weight of 294.26 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[2-(carboxylatomethylamino)-2-oxoethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3R,4R)-3-[[2-(carboxylatomethylamino)-2-oxoethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11896387 |
| Molecular Formula | C13H14N2O6-2 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[2-(carboxylatomethylamino)-2-oxoethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])CNC(=O)CNC(=O)[C@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H16N2O6/c16-8(14-5-9(17)18)4-15-12(19)10-6-1-2-7(3-6)11(10)13(20)21/h1-2,6-7,10-11H,3-5H2,(H,14,16)(H,15,19)(H,17,18)(H,20,21)/p-2/t6-,7+,10+,11-/m0/s1 |
| InChIKey | KIMYKZICBDZYHY-HJGGDWJDSA-L |
| XLogP | -3.84 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|