C15H24N2O2 — CID 131880221
(1R,2R,3R,4S)-2-N,3-N-dipropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 131880221) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R,2R,3R,4S)-2-N,3-N-dipropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-2-N,3-N-dipropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 131880221 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (1R,2R,3R,4S)-2-N,3-N-dipropylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H](C(=O)NCCC)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H24N2O2/c1-3-7-16-14(18)12-10-5-6-11(9-10)13(12)15(19)17-8-4-2/h5-6,10-13H,3-4,7-9H2,1-2H3,(H,16,18)(H,17,19)/t10-,11+,12-,13-/m1/s1 |
| InChIKey | PRAKLPLBXKEVOJ-YVECIDJPSA-N |
| XLogP | 1.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|