C15H22NO3- — CID 2053692
(1S,2S,3S,4R)-3-(hexylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 2053692) has the molecular formula C15H22NO3- and a molecular weight of 264.34 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(hexylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3S,4R)-3-(hexylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 2053692 |
| Molecular Formula | C15H22NO3- |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (1S,2S,3S,4R)-3-(hexylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCCCCCNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H23NO3/c1-2-3-4-5-8-16-14(17)12-10-6-7-11(9-10)13(12)15(18)19/h6-7,10-13H,2-5,8-9H2,1H3,(H,16,17)(H,18,19)/p-1/t10-,11+,12-,13-/m0/s1 |
| InChIKey | KZRJOPNRIDRNJU-RNJOBUHISA-M |
| XLogP | 0.87 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|