C16H17N2O3- — CID 50936509
(1S,2S,3R,4R)-3-(2-pyridin-4-ylethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 50936509) has the molecular formula C16H17N2O3- and a molecular weight of 285.32 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-(2-pyridin-4-ylethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3R,4R)-3-(2-pyridin-4-ylethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 50936509 |
| Molecular Formula | C16H17N2O3- |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (1S,2S,3R,4R)-3-(2-pyridin-4-ylethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)NCCc2ccncc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H18N2O3/c19-15(18-8-5-10-3-6-17-7-4-10)13-11-1-2-12(9-11)14(13)16(20)21/h1-4,6-7,11-14H,5,8-9H2,(H,18,19)(H,20,21)/p-1/t11-,12+,13+,14-/m0/s1 |
| InChIKey | RPUZUGCWRTXDBT-DGAVXFQQSA-M |
| XLogP | -0.07 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|