C15H15N2O3- — CID 3564825
3-(pyridin-4-ylmethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 3564825) has the molecular formula C15H15N2O3- and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-(pyridin-4-ylmethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 3-(pyridin-4-ylmethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 3564825 |
| Molecular Formula | C15H15N2O3- |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-(pyridin-4-ylmethylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])C1C2C=CC(C2)C1C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C15H16N2O3/c18-14(17-8-9-3-5-16-6-4-9)12-10-1-2-11(7-10)13(12)15(19)20/h1-6,10-13H,7-8H2,(H,17,18)(H,19,20)/p-1 |
| InChIKey | VPQWDGNJPXQZTL-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|