C19H22NO5- — CID 18389048
(1R,2S,3S,4R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18389048) has the molecular formula C19H22NO5- and a molecular weight of 344.39 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2S,3S,4R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18389048 |
| Molecular Formula | C19H22NO5- |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (1R,2S,3S,4R)-3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COc1ccc(CCNC(=O)[C@@H]2[C@@H](C(=O)[O-])[C@H]3C=C[C@H]2C3)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-24-14-6-3-11(9-15(14)25-2)7-8-20-18(21)16-12-4-5-13(10-12)17(16)19(22)23/h3-6,9,12-13,16-17H,7-8,10H2,1-2H3,(H,20,21)(H,22,23)/p-1/t12-,13-,16-,17-/m0/s1 |
| InChIKey | REYPTNTVIZTNMC-PYTWLRIVSA-M |
| XLogP | 0.55 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|