C15H26 — CID 20593329
5,6-ditert-butylbicyclo[2.2.1]hept-2-ene (PubChem CID 20593329) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 5,6-ditert-butylbicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-ditert-butylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 20593329 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 5,6-ditert-butylbicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)(C)C1C2C=CC(C2)C1C(C)(C)C |
| InChI | InChI=1S/C15H26/c1-14(2,3)12-10-7-8-11(9-10)13(12)15(4,5)6/h7-8,10-13H,9H2,1-6H3 |
| InChIKey | BEONTHBUBSPTPJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|