C10H16S — CID 14110953
(1S,3R,4R)-3-tert-butyl-2-thiabicyclo[2.2.1]hept-5-ene (PubChem CID 14110953) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is (1S,3R,4R)-3-tert-butyl-2-thiabicyclo[2.2.1]hept-5-ene.
| Compound Name | (1S,3R,4R)-3-tert-butyl-2-thiabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 14110953 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (1S,3R,4R)-3-tert-butyl-2-thiabicyclo[2.2.1]hept-5-ene |
| SMILES | CC(C)(C)[C@@H]1S[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C10H16S/c1-10(2,3)9-7-4-5-8(6-7)11-9/h4-5,7-9H,6H2,1-3H3/t7-,8+,9+/m0/s1 |
| InChIKey | RNLCPBMJLPXPMA-DJLDLDEBSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|