C14H24 — CID 13283199
3,6-ditert-butylcyclohexa-1,4-diene (PubChem CID 13283199) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 3,6-ditert-butylcyclohexa-1,4-diene.
| Compound Name | 3,6-ditert-butylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 13283199 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3,6-ditert-butylcyclohexa-1,4-diene |
| SMILES | CC(C)(C)C1C=CC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C14H24/c1-13(2,3)11-7-9-12(10-8-11)14(4,5)6/h7-12H,1-6H3 |
| InChIKey | ZOXPEVJJAJMVAU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|