C16H24 — CID 165044993
1,5-ditert-butyl-1,5-dihydropentalene (PubChem CID 165044993) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,5-ditert-butyl-1,5-dihydropentalene.
| Compound Name | 1,5-ditert-butyl-1,5-dihydropentalene |
|---|---|
| PubChem CID | 165044993 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,5-ditert-butyl-1,5-dihydropentalene |
| SMILES | CC(C)(C)C1C=C2C=CC(C(C)(C)C)C2=C1 |
| InChI | InChI=1S/C16H24/c1-15(2,3)12-9-11-7-8-14(13(11)10-12)16(4,5)6/h7-10,12,14H,1-6H3 |
| InChIKey | DAOCPQBVFNVPRF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |