C15H27P — CID 170690127
(3-tert-butylcyclopenta-1,4-dien-1-yl)-di(propan-2-yl)phosphane (PubChem CID 170690127) has the molecular formula C15H27P and a molecular weight of 238.35 g/mol. Its IUPAC name is (3-tert-butylcyclopenta-1,4-dien-1-yl)-di(propan-2-yl)phosphane.
| Compound Name | (3-tert-butylcyclopenta-1,4-dien-1-yl)-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 170690127 |
| Molecular Formula | C15H27P |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3-tert-butylcyclopenta-1,4-dien-1-yl)-di(propan-2-yl)phosphane |
| SMILES | CC(C)P(C1=CC(C(C)(C)C)C=C1)C(C)C |
| InChI | InChI=1S/C15H27P/c1-11(2)16(12(3)4)14-9-8-13(10-14)15(5,6)7/h8-13H,1-7H3 |
| InChIKey | LBNWUGOZVZKIOX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|