C22H36Si2 — CID 101094449
5,11-di(butan-2-yl)-2,2,8,8-tetramethyl-2,8-disilatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene (PubChem CID 101094449) has the molecular formula C22H36Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is 5,11-di(butan-2-yl)-2,2,8,8-tetramethyl-2,8-disilatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene.
| Compound Name | 5,11-di(butan-2-yl)-2,2,8,8-tetramethyl-2,8-disilatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
|---|---|
| PubChem CID | 101094449 |
| Molecular Formula | C22H36Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 5,11-di(butan-2-yl)-2,2,8,8-tetramethyl-2,8-disilatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
| SMILES | CCC(C)C1C=C2C(=C1)[Si](C)(C)C1=CC(C(C)CC)C=C1[Si]2(C)C |
| InChI | InChI=1S/C22H36Si2/c1-9-15(3)17-11-19-20(12-17)24(7,8)22-14-18(16(4)10-2)13-21(22)23(19,5)6/h11-18H,9-10H2,1-8H3 |
| InChIKey | PQYTXJZVMHOIHA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|