C11H23N — CID 123532822
2,3-di(butan-2-yl)cyclopropan-1-amine (PubChem CID 123532822) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 2,3-di(butan-2-yl)cyclopropan-1-amine.
| Compound Name | 2,3-di(butan-2-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 123532822 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2,3-di(butan-2-yl)cyclopropan-1-amine |
| SMILES | CCC(C)C1C(N)C1C(C)CC |
| InChI | InChI=1S/C11H23N/c1-5-7(3)9-10(11(9)12)8(4)6-2/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | KIMSYOBVQRHGKT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |