C12H24 — CID 123219049
2-butan-2-yl-1,3-dimethylcyclohexane (PubChem CID 123219049) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-dimethylcyclohexane.
| Compound Name | 2-butan-2-yl-1,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 123219049 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 2-butan-2-yl-1,3-dimethylcyclohexane |
| SMILES | CCC(C)C1C(C)CCCC1C |
| InChI | InChI=1S/C12H24/c1-5-9(2)12-10(3)7-6-8-11(12)4/h9-12H,5-8H2,1-4H3 |
| InChIKey | CKKDJLRXKXHENX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |